C21H20N4P+ — CID 139186156
6,10-dibenzyl-3,6,10-triaza-1-azonia-8-phosphatricyclo[7.3.0.03,7]dodeca-1(9),4,7,11-tetraene (PubChem CID 139186156) has the molecular formula C21H20N4P+ and a molecular weight of 359.39 g/mol. Its IUPAC name is 6,10-dibenzyl-3,6,10-triaza-1-azonia-8-phosphatricyclo[7.3.0.03,7]dodeca-1(9),4,7,11-tetraene.
| Compound Name | 6,10-dibenzyl-3,6,10-triaza-1-azonia-8-phosphatricyclo[7.3.0.03,7]dodeca-1(9),4,7,11-tetraene |
|---|---|
| PubChem CID | 139186156 |
| Molecular Formula | C21H20N4P+ |
| Molecular Weight | 359.39 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | 6,10-dibenzyl-3,6,10-triaza-1-azonia-8-phosphatricyclo[7.3.0.03,7]dodeca-1(9),4,7,11-tetraene |
| SMILES | C1=CN2C[n+]3ccn(Cc4ccccc4)c3P=C2N1Cc1ccccc1 |
| InChI | InChI=1S/C21H20N4P/c1-3-7-18(8-4-1)15-22-11-13-24-17-25-14-12-23(21(25)26-20(22)24)16-19-9-5-2-6-10-19/h1-14H,15-17H2/q+1 |
| InChIKey | ZDNFNVPSPLDYAO-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 15.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.39 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|