C22H17F2N — CID 139186375
1,1-bis(4-fluorophenyl)-N-[(Z)-2-(4-methylphenyl)ethenyl]methanimine (PubChem CID 139186375) has the molecular formula C22H17F2N and a molecular weight of 333.38 g/mol. Its IUPAC name is 1,1-bis(4-fluorophenyl)-N-[(Z)-2-(4-methylphenyl)ethenyl]methanimine.
| Compound Name | 1,1-bis(4-fluorophenyl)-N-[(Z)-2-(4-methylphenyl)ethenyl]methanimine |
|---|---|
| PubChem CID | 139186375 |
| Molecular Formula | C22H17F2N |
| Molecular Weight | 333.38 g/mol |
| Exact Mass | 333.13 |
| IUPAC Name | 1,1-bis(4-fluorophenyl)-N-[(Z)-2-(4-methylphenyl)ethenyl]methanimine |
| SMILES | Cc1ccc(/C=C\N=C(c2ccc(F)cc2)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C22H17F2N/c1-16-2-4-17(5-3-16)14-15-25-22(18-6-10-20(23)11-7-18)19-8-12-21(24)13-9-19/h2-15H,1H3/b15-14- |
| InChIKey | WIIMLYIBPDUEIE-PFONDFGASA-N |
| XLogP | 5.78 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.38 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|