C48H32Br6N2 — CID 139186376
2,4-bis(4-bromophenyl)-6-[(4-bromophenyl)methyl]pyridine (PubChem CID 139186376) has the molecular formula C48H32Br6N2 and a molecular weight of 1116.22 g/mol. Its IUPAC name is 2,4-bis(4-bromophenyl)-6-[(4-bromophenyl)methyl]pyridine.
| Compound Name | 2,4-bis(4-bromophenyl)-6-[(4-bromophenyl)methyl]pyridine |
|---|---|
| PubChem CID | 139186376 |
| Molecular Formula | C48H32Br6N2 |
| Molecular Weight | 1116.22 g/mol |
| Exact Mass | 1109.77 |
| IUPAC Name | 2,4-bis(4-bromophenyl)-6-[(4-bromophenyl)methyl]pyridine |
| SMILES | Brc1ccc(Cc2cc(-c3ccc(Br)cc3)cc(-c3ccc(Br)cc3)n2)cc1.Brc1ccc(Cc2cc(-c3ccc(Br)cc3)cc(-c3ccc(Br)cc3)n2)cc1 |
| InChI | InChI=1S/2C24H16Br3N/c2*25-20-7-1-16(2-8-20)13-23-14-19(17-3-9-21(26)10-4-17)15-24(28-23)18-5-11-22(27)12-6-18/h2*1-12,14-15H,13H2 |
| InChIKey | AYYRGOYZJYWQJM-UHFFFAOYSA-N |
| XLogP | 16.59 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1116.22 |
| LogP ≤ 5 | 16.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |