About bis(4-chloro-2-(quinolin-8-yliminomethyl)phenolate);iron(2+)
bis(4-chloro-2-(quinolin-8-yliminomethyl)phenolate);iron(2+) (PubChem CID 139187307) has the molecular formula C32H20Cl2FeN4O2
and a molecular weight of 619.29 g/mol. Its IUPAC name is bis(4-chloro-2-(quinolin-8-yliminomethyl)phenolate);iron(2+).
Molecular Properties
| Compound Name | bis(4-chloro-2-(quinolin-8-yliminomethyl)phenolate);iron(2+) |
| PubChem CID | 139187307 |
| Molecular Formula | C32H20Cl2FeN4O2 |
| Molecular Weight | 619.29 g/mol |
| Exact Mass | 618.03 |
| IUPAC Name | bis(4-chloro-2-(quinolin-8-yliminomethyl)phenolate);iron(2+) |
| SMILES | [Fe+2].[O-]c1ccc(Cl)cc1/C=N/c1cccc2cccnc12.[O-]c1ccc(Cl)cc1C=Nc1cccc2cccnc12 |
| InChI | InChI=1S/2C16H11ClN2O.Fe/c2*17-13-6-7-15(20)12(9-13)10-19-14-5-1-3-11-4-2-8-18-16(11)14;/h2*1-10,20H;/q;;+2/p-2/b19-10+;; |
| InChIKey | QTRCBWSSGPXXDV-DLFBYYCRSA-L |
| XLogP | 7.42 |
| TPSA | 96.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 619.29 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze bis(4-chloro-2-(quinolin-8-yliminomethyl)phenolate);iron(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(4-chloro-2-(quinolin-8-yliminomethyl)phenolate);iron(2+)?
The IUPAC name of bis(4-chloro-2-(quinolin-8-yliminomethyl)phenolate);iron(2+) (CID 139187307) is bis(4-chloro-2-(quinolin-8-yliminomethyl)phenolate);iron(2+).
What is the SMILES notation for bis(4-chloro-2-(quinolin-8-yliminomethyl)phenolate);iron(2+)?
The canonical SMILES for bis(4-chloro-2-(quinolin-8-yliminomethyl)phenolate);iron(2+) is [Fe+2].[O-]c1ccc(Cl)cc1/C=N/c1cccc2cccnc12.[O-]c1ccc(Cl)cc1C=Nc1cccc2cccnc12.
What is the InChIKey of bis(4-chloro-2-(quinolin-8-yliminomethyl)phenolate);iron(2+)?
The InChIKey is QTRCBWSSGPXXDV-DLFBYYCRSA-L. The full InChI is InChI=1S/2C16H11ClN2O.Fe/c2*17-13-6-7-15(20)12(9-13)10-19-14-5-1-3-11-4-2-8-18-16(11)14;/h2*1-10,20H;/q;;+2/p-2/b19-10+;;.
What are the key properties of bis(4-chloro-2-(quinolin-8-yliminomethyl)phenolate);iron(2+)?
bis(4-chloro-2-(quinolin-8-yliminomethyl)phenolate);iron(2+) has a molecular weight of 619.29 g/mol, XLogP of 7.42, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(4-chloro-2-(quinolin-8-yliminomethyl)phenolate);iron(2+) is sourced from PubChem (CID 139187307), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).