About CID 139188613
CID 139188613 (PubChem CID 139188613) has the molecular formula C45H30F6N5NiPS
and a molecular weight of 876.49 g/mol.
Molecular Properties
| Compound Name | CID 139188613 |
| PubChem CID | 139188613 |
| Molecular Formula | C45H30F6N5NiPS |
| Molecular Weight | 876.49 g/mol |
| Exact Mass | 875.12 |
| IUPAC Name | — |
| SMILES | Cc1ccc(/C2=c3\cc/c([n-]3)=C(\c3ccccc3)c3ccc([n-]3)[C+](c3ccc(C)cc3)c3ccc([n-]3)-c3[s+]c4cccc[n+]4c4cc2[n-]c34)cc1.F[P-](F)(F)(F)(F)F.[Ni+2] |
| InChI | InChI=1S/C45H30N5S.F6P.Ni/c1-27-11-15-30(16-12-27)42-34-20-19-32(46-34)41(29-8-4-3-5-9-29)33-21-22-36(47-33)43(31-17-13-28(2)14-18-31)38-26-39-44(49-38)45(37-24-23-35(42)48-37)51-40-10-6-7-25-50(39)40;1-7(2,3,4,5)6;/h3-26H,1-2H3;;/q2*-1;+2/b41-33-,43-36-;; |
| InChIKey | BOMRLVWNGIRHFL-GIIKXRBGSA-N |
| XLogP | 10.24 |
| TPSA | 60.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 59 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 876.49 |
| LogP ≤ 5 | 10.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze CID 139188613 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 139188613?
The IUPAC name of CID 139188613 (CID 139188613) is not available.
What is the SMILES notation for CID 139188613?
The canonical SMILES for CID 139188613 is Cc1ccc(/C2=c3\cc/c([n-]3)=C(\c3ccccc3)c3ccc([n-]3)[C+](c3ccc(C)cc3)c3ccc([n-]3)-c3[s+]c4cccc[n+]4c4cc2[n-]c34)cc1.F[P-](F)(F)(F)(F)F.[Ni+2].
What is the InChIKey of CID 139188613?
The InChIKey is BOMRLVWNGIRHFL-GIIKXRBGSA-N. The full InChI is InChI=1S/C45H30N5S.F6P.Ni/c1-27-11-15-30(16-12-27)42-34-20-19-32(46-34)41(29-8-4-3-5-9-29)33-21-22-36(47-33)43(31-17-13-28(2)14-18-31)38-26-39-44(49-38)45(37-24-23-35(42)48-37)51-40-10-6-7-25-50(39)40;1-7(2,3,4,5)6;/h3-26H,1-2H3;;/q2*-1;+2/b41-33-,43-36-;;.
What are the key properties of CID 139188613?
CID 139188613 has a molecular weight of 876.49 g/mol, XLogP of 10.24, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 139188613 is sourced from PubChem (CID 139188613), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).