C35H32N2O4 — CID 139189881
CID 139189881 (PubChem CID 139189881) has the molecular formula C35H32N2O4 and a molecular weight of 544.65 g/mol.
| Compound Name | CID 139189881 |
|---|---|
| PubChem CID | 139189881 |
| Molecular Formula | C35H32N2O4 |
| Molecular Weight | 544.65 g/mol |
| Exact Mass | 544.24 |
| IUPAC Name | — |
| SMILES | O.O=C1C(=O)[C@]2(CC[C@]3(C(=O)N(Cc4ccccc4)c4ccccc43)[C@@H]2c2ccccc2)CN1Cc1ccccc1 |
| InChI | InChI=1S/C35H30N2O3.H2O/c38-31-32(39)36(22-25-12-4-1-5-13-25)24-34(31)20-21-35(30(34)27-16-8-3-9-17-27)28-18-10-11-19-29(28)37(33(35)40)23-26-14-6-2-7-15-26;/h1-19,30H,20-24H2;1H2/t30-,34-,35-;/m1./s1 |
| InChIKey | GDRYPMYGKVLPKB-VCMGWZQJSA-N |
| XLogP | 4.82 |
| TPSA | 89.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.65 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|