C39H30F3N3O3 — CID 164679343
CID 164679343 (PubChem CID 164679343) has the molecular formula C39H30F3N3O3 and a molecular weight of 645.68 g/mol.
| Compound Name | CID 164679343 |
|---|---|
| PubChem CID | 164679343 |
| Molecular Formula | C39H30F3N3O3 |
| Molecular Weight | 645.68 g/mol |
| Exact Mass | 645.22 |
| IUPAC Name | — |
| SMILES | O=C1C(=O)[C@@]2(CN1Cc1ccccc1)[C@H](c1cccc3ccccc13)[C@@H](C(F)(F)F)N[C@]21C(=O)N(Cc2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C39H30F3N3O3/c40-39(41,42)33-32(29-19-11-17-27-16-7-8-18-28(27)29)37(24-44(35(47)34(37)46)22-25-12-3-1-4-13-25)38(43-33)30-20-9-10-21-31(30)45(36(38)48)23-26-14-5-2-6-15-26/h1-21,32-33,43H,22-24H2/t32-,33+,37-,38-/m1/s1 |
| InChIKey | ZLUWHQMCCBVXIX-WBZZMTOKSA-N |
| XLogP | 6.50 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.68 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|