C19H23NO6 — CID 139190150
3-O-ethyl 1-O,2-O-dimethyl (1R,2S,3S,10bS)-1,2,3,5,6,10b-hexahydropyrrolo[2,1-a]isoquinoline-1,2,3-tricarboxylate (PubChem CID 139190150) has the molecular formula C19H23NO6 and a molecular weight of 361.39 g/mol. Its IUPAC name is 3-O-ethyl 1-O,2-O-dimethyl (1R,2S,3S,10bS)-1,2,3,5,6,10b-hexahydropyrrolo[2,1-a]isoquinoline-1,2,3-tricarboxylate.
| Compound Name | 3-O-ethyl 1-O,2-O-dimethyl (1R,2S,3S,10bS)-1,2,3,5,6,10b-hexahydropyrrolo[2,1-a]isoquinoline-1,2,3-tricarboxylate |
|---|---|
| PubChem CID | 139190150 |
| Molecular Formula | C19H23NO6 |
| Molecular Weight | 361.39 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | 3-O-ethyl 1-O,2-O-dimethyl (1R,2S,3S,10bS)-1,2,3,5,6,10b-hexahydropyrrolo[2,1-a]isoquinoline-1,2,3-tricarboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@@H](C(=O)OC)[C@@H](C(=O)OC)[C@H]2c3ccccc3CCN12 |
| InChI | InChI=1S/C19H23NO6/c1-4-26-19(23)16-14(18(22)25-3)13(17(21)24-2)15-12-8-6-5-7-11(12)9-10-20(15)16/h5-8,13-16H,4,9-10H2,1-3H3/t13-,14+,15-,16+/m1/s1 |
| InChIKey | UUGVPOOBFVOKAK-QXSJWSMHSA-N |
| XLogP | 1.11 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.39 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|