C64H32N14O2S4 — CID 139190493
1,4-dimethoxybenzene;bis(2-[5-[1-phenyl-5-[5-(1,2,2-tricyanoethenyl)thiophen-2-yl]pyrrol-2-yl]thiophen-2-yl]ethene-1,1,2-tricarbonitrile) (PubChem CID 139190493) has the molecular formula C64H32N14O2S4 and a molecular weight of 1157.32 g/mol. Its IUPAC name is 1,4-dimethoxybenzene;bis(2-[5-[1-phenyl-5-[5-(1,2,2-tricyanoethenyl)thiophen-2-yl]pyrrol-2-yl]thiophen-2-yl]ethene-1,1,2-tricarbonitrile).
| Compound Name | 1,4-dimethoxybenzene;bis(2-[5-[1-phenyl-5-[5-(1,2,2-tricyanoethenyl)thiophen-2-yl]pyrrol-2-yl]thiophen-2-yl]ethene-1,1,2-tricarbonitrile) |
|---|---|
| PubChem CID | 139190493 |
| Molecular Formula | C64H32N14O2S4 |
| Molecular Weight | 1157.32 g/mol |
| Exact Mass | 1156.17 |
| IUPAC Name | 1,4-dimethoxybenzene;bis(2-[5-[1-phenyl-5-[5-(1,2,2-tricyanoethenyl)thiophen-2-yl]pyrrol-2-yl]thiophen-2-yl]ethene-1,1,2-tricarbonitrile) |
| SMILES | COc1ccc(OC)cc1.N#CC(C#N)=C(C#N)c1ccc(-c2ccc(-c3ccc(C(C#N)=C(C#N)C#N)s3)n2-c2ccccc2)s1.N#CC(C#N)=C(C#N)c1ccc(-c2ccc(-c3ccc(C(C#N)=C(C#N)C#N)s3)n2-c2ccccc2)s1 |
| InChI | InChI=1S/2C28H11N7S2.C8H10O2/c2*29-12-18(13-30)21(16-33)25-8-10-27(36-25)23-6-7-24(35(23)20-4-2-1-3-5-20)28-11-9-26(37-28)22(17-34)19(14-31)15-32;1-9-7-3-5-8(10-2)6-4-7/h2*1-11H;3-6H,1-2H3 |
| InChIKey | AXSNNVFUPWIRLA-UHFFFAOYSA-N |
| XLogP | 14.87 |
| TPSA | 313.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 84 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1157.32 |
| LogP ≤ 5 | 14.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|