C44H36N4O2 — CID 139190874
(3R)-3-indazol-1-yl-1,3-diphenylpropan-1-one (PubChem CID 139190874) has the molecular formula C44H36N4O2 and a molecular weight of 652.80 g/mol. Its IUPAC name is (3R)-3-indazol-1-yl-1,3-diphenylpropan-1-one.
| Compound Name | (3R)-3-indazol-1-yl-1,3-diphenylpropan-1-one |
|---|---|
| PubChem CID | 139190874 |
| Molecular Formula | C44H36N4O2 |
| Molecular Weight | 652.80 g/mol |
| Exact Mass | 652.28 |
| IUPAC Name | (3R)-3-indazol-1-yl-1,3-diphenylpropan-1-one |
| SMILES | O=C(C[C@H](c1ccccc1)n1ncc2ccccc21)c1ccccc1.O=C(C[C@H](c1ccccc1)n1ncc2ccccc21)c1ccccc1 |
| InChI | InChI=1S/2C22H18N2O/c2*25-22(18-11-5-2-6-12-18)15-21(17-9-3-1-4-10-17)24-20-14-8-7-13-19(20)16-23-24/h2*1-14,16,21H,15H2/t2*21-/m11/s1 |
| InChIKey | RCAXPDCIQAKGIU-PRFAJPDFSA-N |
| XLogP | 9.80 |
| TPSA | 69.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.80 |
| LogP ≤ 5 | 9.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |