C38H26N2 — CID 139192401
6-methyl-2,3,9,10-tetraphenyl-14-azonia-12-azanidatetracyclo[6.5.2.04,15.011,14]pentadeca-1(13),2,4(15),5,7,9,11(14)-heptaene (PubChem CID 139192401) has the molecular formula C38H26N2 and a molecular weight of 510.64 g/mol. Its IUPAC name is 6-methyl-2,3,9,10-tetraphenyl-14-azonia-12-azanidatetracyclo[6.5.2.04,15.011,14]pentadeca-1(13),2,4(15),5,7,9,11(14)-heptaene.
| Compound Name | 6-methyl-2,3,9,10-tetraphenyl-14-azonia-12-azanidatetracyclo[6.5.2.04,15.011,14]pentadeca-1(13),2,4(15),5,7,9,11(14)-heptaene |
|---|---|
| PubChem CID | 139192401 |
| Molecular Formula | C38H26N2 |
| Molecular Weight | 510.64 g/mol |
| Exact Mass | 510.21 |
| IUPAC Name | 6-methyl-2,3,9,10-tetraphenyl-14-azonia-12-azanidatetracyclo[6.5.2.04,15.011,14]pentadeca-1(13),2,4(15),5,7,9,11(14)-heptaene |
| SMILES | Cc1cc2c(-c3ccccc3)c(-c3ccccc3)c3c[n-]c4c(-c5ccccc5)c(-c5ccccc5)c(c1)c2[n+]34 |
| InChI | InChI=1S/C38H26N2/c1-25-22-30-33(26-14-6-2-7-15-26)35(28-18-10-4-11-19-28)32-24-39-38-36(29-20-12-5-13-21-29)34(27-16-8-3-9-17-27)31(23-25)37(30)40(32)38/h2-24H,1H3 |
| InChIKey | MWROHGLOHJSCBI-UHFFFAOYSA-N |
| XLogP | 9.10 |
| TPSA | 18.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.64 |
| LogP ≤ 5 | 9.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|