C17H12F4IN3O2 — CID 139192978
5-iodo-4-phenyl-1-[1,1,2,2-tetrafluoro-2-(4-methoxyphenoxy)ethyl]triazole (PubChem CID 139192978) has the molecular formula C17H12F4IN3O2 and a molecular weight of 493.20 g/mol. Its IUPAC name is 5-iodo-4-phenyl-1-[1,1,2,2-tetrafluoro-2-(4-methoxyphenoxy)ethyl]triazole.
| Compound Name | 5-iodo-4-phenyl-1-[1,1,2,2-tetrafluoro-2-(4-methoxyphenoxy)ethyl]triazole |
|---|---|
| PubChem CID | 139192978 |
| Molecular Formula | C17H12F4IN3O2 |
| Molecular Weight | 493.20 g/mol |
| Exact Mass | 492.99 |
| IUPAC Name | 5-iodo-4-phenyl-1-[1,1,2,2-tetrafluoro-2-(4-methoxyphenoxy)ethyl]triazole |
| SMILES | COc1ccc(OC(F)(F)C(F)(F)n2nnc(-c3ccccc3)c2I)cc1 |
| InChI | InChI=1S/C17H12F4IN3O2/c1-26-12-7-9-13(10-8-12)27-17(20,21)16(18,19)25-15(22)14(23-24-25)11-5-3-2-4-6-11/h2-10H,1H3 |
| InChIKey | YHHUDOMALFYNAS-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.20 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|