C24H18F4N2O — CID 171363029
4-(4-methylphenyl)-2-phenyl-1-(1,1,2,2-tetrafluoro-2-phenoxyethyl)imidazole (PubChem CID 171363029) has the molecular formula C24H18F4N2O and a molecular weight of 426.41 g/mol. Its IUPAC name is 4-(4-methylphenyl)-2-phenyl-1-(1,1,2,2-tetrafluoro-2-phenoxyethyl)imidazole.
| Compound Name | 4-(4-methylphenyl)-2-phenyl-1-(1,1,2,2-tetrafluoro-2-phenoxyethyl)imidazole |
|---|---|
| PubChem CID | 171363029 |
| Molecular Formula | C24H18F4N2O |
| Molecular Weight | 426.41 g/mol |
| Exact Mass | 426.14 |
| IUPAC Name | 4-(4-methylphenyl)-2-phenyl-1-(1,1,2,2-tetrafluoro-2-phenoxyethyl)imidazole |
| SMILES | Cc1ccc(-c2cn(C(F)(F)C(F)(F)Oc3ccccc3)c(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C24H18F4N2O/c1-17-12-14-18(15-13-17)21-16-30(22(29-21)19-8-4-2-5-9-19)23(25,26)24(27,28)31-20-10-6-3-7-11-20/h2-16H,1H3 |
| InChIKey | CUPZGFRVDIKCJE-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.41 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|