C28H21BrF3NO4 — CID 139194167
ethyl (2'R,3'S,5'R)-3'-(4-bromophenyl)-1,3-dioxo-5'-phenyl-2'-(trifluoromethyl)spiro[indene-2,4'-pyrrolidine]-2'-carboxylate (PubChem CID 139194167) has the molecular formula C28H21BrF3NO4 and a molecular weight of 572.38 g/mol. Its IUPAC name is ethyl (2'R,3'S,5'R)-3'-(4-bromophenyl)-1,3-dioxo-5'-phenyl-2'-(trifluoromethyl)spiro[indene-2,4'-pyrrolidine]-2'-carboxylate.
| Compound Name | ethyl (2'R,3'S,5'R)-3'-(4-bromophenyl)-1,3-dioxo-5'-phenyl-2'-(trifluoromethyl)spiro[indene-2,4'-pyrrolidine]-2'-carboxylate |
|---|---|
| PubChem CID | 139194167 |
| Molecular Formula | C28H21BrF3NO4 |
| Molecular Weight | 572.38 g/mol |
| Exact Mass | 571.06 |
| IUPAC Name | ethyl (2'R,3'S,5'R)-3'-(4-bromophenyl)-1,3-dioxo-5'-phenyl-2'-(trifluoromethyl)spiro[indene-2,4'-pyrrolidine]-2'-carboxylate |
| SMILES | CCOC(=O)[C@]1(C(F)(F)F)N[C@H](c2ccccc2)C2(C(=O)c3ccccc3C2=O)[C@@H]1c1ccc(Br)cc1 |
| InChI | InChI=1S/C28H21BrF3NO4/c1-2-37-25(36)27(28(30,31)32)21(16-12-14-18(29)15-13-16)26(22(33-27)17-8-4-3-5-9-17)23(34)19-10-6-7-11-20(19)24(26)35/h3-15,21-22,33H,2H2,1H3/t21-,22+,27+/m0/s1 |
| InChIKey | MWYLMQMNDXBYSB-OREGWCPLSA-N |
| XLogP | 5.81 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.38 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|