C29H27BrFNO4 — CID 132543108
methyl (1S,3S,6aR)-1-(3-bromo-4-fluorophenyl)-3,4,4-trimethyl-6a-(naphthalene-2-carbonyl)-6-oxo-1,2,3a,5-tetrahydrocyclopenta[c]pyrrole-3-carboxylate (PubChem CID 132543108) has the molecular formula C29H27BrFNO4 and a molecular weight of 552.44 g/mol. Its IUPAC name is methyl (1S,3S,6aR)-1-(3-bromo-4-fluorophenyl)-3,4,4-trimethyl-6a-(naphthalene-2-carbonyl)-6-oxo-1,2,3a,5-tetrahydrocyclopenta[c]pyrrole-3-carboxylate.
| Compound Name | methyl (1S,3S,6aR)-1-(3-bromo-4-fluorophenyl)-3,4,4-trimethyl-6a-(naphthalene-2-carbonyl)-6-oxo-1,2,3a,5-tetrahydrocyclopenta[c]pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 132543108 |
| Molecular Formula | C29H27BrFNO4 |
| Molecular Weight | 552.44 g/mol |
| Exact Mass | 551.11 |
| IUPAC Name | methyl (1S,3S,6aR)-1-(3-bromo-4-fluorophenyl)-3,4,4-trimethyl-6a-(naphthalene-2-carbonyl)-6-oxo-1,2,3a,5-tetrahydrocyclopenta[c]pyrrole-3-carboxylate |
| SMILES | COC(=O)[C@@]1(C)N[C@@H](c2ccc(F)c(Br)c2)[C@@]2(C(=O)c3ccc4ccccc4c3)C(=O)CC(C)(C)C21 |
| InChI | InChI=1S/C29H27BrFNO4/c1-27(2)15-22(33)29(24(34)19-10-9-16-7-5-6-8-17(16)13-19)23(18-11-12-21(31)20(30)14-18)32-28(3,25(27)29)26(35)36-4/h5-14,23,25,32H,15H2,1-4H3/t23-,25?,28-,29+/m0/s1 |
| InChIKey | RGDATPPBAPWNFH-LAYJLTFMSA-N |
| XLogP | 5.80 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.44 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|