C27H22BrNO4 — CID 177433359
ethyl (2'R,3'R,5'S)-3'-(4-bromophenyl)-1,3-dioxo-5'-phenylspiro[indene-2,4'-pyrrolidine]-2'-carboxylate (PubChem CID 177433359) has the molecular formula C27H22BrNO4 and a molecular weight of 504.38 g/mol. Its IUPAC name is ethyl (2'R,3'R,5'S)-3'-(4-bromophenyl)-1,3-dioxo-5'-phenylspiro[indene-2,4'-pyrrolidine]-2'-carboxylate.
| Compound Name | ethyl (2'R,3'R,5'S)-3'-(4-bromophenyl)-1,3-dioxo-5'-phenylspiro[indene-2,4'-pyrrolidine]-2'-carboxylate |
|---|---|
| PubChem CID | 177433359 |
| Molecular Formula | C27H22BrNO4 |
| Molecular Weight | 504.38 g/mol |
| Exact Mass | 503.07 |
| IUPAC Name | ethyl (2'R,3'R,5'S)-3'-(4-bromophenyl)-1,3-dioxo-5'-phenylspiro[indene-2,4'-pyrrolidine]-2'-carboxylate |
| SMILES | CCOC(=O)[C@@H]1N[C@@H](c2ccccc2)C2(C(=O)c3ccccc3C2=O)[C@H]1c1ccc(Br)cc1 |
| InChI | InChI=1S/C27H22BrNO4/c1-2-33-26(32)22-21(16-12-14-18(28)15-13-16)27(23(29-22)17-8-4-3-5-9-17)24(30)19-10-6-7-11-20(19)25(27)31/h3-15,21-23,29H,2H2,1H3/t21-,22+,23-/m0/s1 |
| InChIKey | CYIKMMBZCNVRIO-ZRBLBEILSA-N |
| XLogP | 4.87 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.38 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|