C30H31NO3 — CID 164679184
tert-butyl (2S,2'S,3'S,5'S)-6-methyl-3-oxo-3',5'-diphenylspiro[1H-indene-2,4'-pyrrolidine]-2'-carboxylate (PubChem CID 164679184) has the molecular formula C30H31NO3 and a molecular weight of 453.58 g/mol. Its IUPAC name is tert-butyl (2S,2'S,3'S,5'S)-6-methyl-3-oxo-3',5'-diphenylspiro[1H-indene-2,4'-pyrrolidine]-2'-carboxylate.
| Compound Name | tert-butyl (2S,2'S,3'S,5'S)-6-methyl-3-oxo-3',5'-diphenylspiro[1H-indene-2,4'-pyrrolidine]-2'-carboxylate |
|---|---|
| PubChem CID | 164679184 |
| Molecular Formula | C30H31NO3 |
| Molecular Weight | 453.58 g/mol |
| Exact Mass | 453.23 |
| IUPAC Name | tert-butyl (2S,2'S,3'S,5'S)-6-methyl-3-oxo-3',5'-diphenylspiro[1H-indene-2,4'-pyrrolidine]-2'-carboxylate |
| SMILES | Cc1ccc2c(c1)C[C@]1(C2=O)[C@H](c2ccccc2)[C@@H](C(=O)OC(C)(C)C)N[C@H]1c1ccccc1 |
| InChI | InChI=1S/C30H31NO3/c1-19-15-16-23-22(17-19)18-30(27(23)32)24(20-11-7-5-8-12-20)25(28(33)34-29(2,3)4)31-26(30)21-13-9-6-10-14-21/h5-17,24-26,31H,18H2,1-4H3/t24-,25+,26+,30+/m1/s1 |
| InChIKey | GWKOPXQRKFTSHL-MGLAESSXSA-N |
| XLogP | 5.56 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.58 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |