About (Z)-4-hydroxypent-3-en-2-one;4-[1-(4-hydroxyphenyl)cyclohexyl]phenol;hydrate
(Z)-4-hydroxypent-3-en-2-one;4-[1-(4-hydroxyphenyl)cyclohexyl]phenol;hydrate (PubChem CID 139195469) has the molecular formula C23H30O5
and a molecular weight of 386.49 g/mol. Its IUPAC name is (Z)-4-hydroxypent-3-en-2-one;4-[1-(4-hydroxyphenyl)cyclohexyl]phenol;hydrate.
Molecular Properties
| Compound Name | (Z)-4-hydroxypent-3-en-2-one;4-[1-(4-hydroxyphenyl)cyclohexyl]phenol;hydrate |
| PubChem CID | 139195469 |
| Molecular Formula | C23H30O5 |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | (Z)-4-hydroxypent-3-en-2-one;4-[1-(4-hydroxyphenyl)cyclohexyl]phenol;hydrate |
| SMILES | CC(=O)/C=C(/C)O.O.Oc1ccc(C2(c3ccc(O)cc3)CCCCC2)cc1 |
| InChI | InChI=1S/C18H20O2.C5H8O2.H2O/c19-16-8-4-14(5-9-16)18(12-2-1-3-13-18)15-6-10-17(20)11-7-15;1-4(6)3-5(2)7;/h4-11,19-20H,1-3,12-13H2;3,6H,1-2H3;1H2/b;4-3-; |
| InChIKey | WNFWZWYSTNFAOL-LWFKIUJUSA-N |
| XLogP | 4.56 |
| TPSA | 109.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-4-hydroxypent-3-en-2-one;4-[1-(4-hydroxyphenyl)cyclohexyl]phenol;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-4-hydroxypent-3-en-2-one;4-[1-(4-hydroxyphenyl)cyclohexyl]phenol;hydrate?
The IUPAC name of (Z)-4-hydroxypent-3-en-2-one;4-[1-(4-hydroxyphenyl)cyclohexyl]phenol;hydrate (CID 139195469) is (Z)-4-hydroxypent-3-en-2-one;4-[1-(4-hydroxyphenyl)cyclohexyl]phenol;hydrate.
What is the SMILES notation for (Z)-4-hydroxypent-3-en-2-one;4-[1-(4-hydroxyphenyl)cyclohexyl]phenol;hydrate?
The canonical SMILES for (Z)-4-hydroxypent-3-en-2-one;4-[1-(4-hydroxyphenyl)cyclohexyl]phenol;hydrate is CC(=O)/C=C(/C)O.O.Oc1ccc(C2(c3ccc(O)cc3)CCCCC2)cc1.
What is the InChIKey of (Z)-4-hydroxypent-3-en-2-one;4-[1-(4-hydroxyphenyl)cyclohexyl]phenol;hydrate?
The InChIKey is WNFWZWYSTNFAOL-LWFKIUJUSA-N. The full InChI is InChI=1S/C18H20O2.C5H8O2.H2O/c19-16-8-4-14(5-9-16)18(12-2-1-3-13-18)15-6-10-17(20)11-7-15;1-4(6)3-5(2)7;/h4-11,19-20H,1-3,12-13H2;3,6H,1-2H3;1H2/b;4-3-;.
What are the key properties of (Z)-4-hydroxypent-3-en-2-one;4-[1-(4-hydroxyphenyl)cyclohexyl]phenol;hydrate?
(Z)-4-hydroxypent-3-en-2-one;4-[1-(4-hydroxyphenyl)cyclohexyl]phenol;hydrate has a molecular weight of 386.49 g/mol, XLogP of 4.56, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-4-hydroxypent-3-en-2-one;4-[1-(4-hydroxyphenyl)cyclohexyl]phenol;hydrate is sourced from PubChem (CID 139195469), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).