C44H30B2N2O2S2 — CID 139196043
13,13,27,27-tetraphenyl-14,28-dioxa-5,19-dithia-12,26-diazonia-13,27-diboranuidaheptacyclo[15.11.0.03,15.04,12.06,11.018,26.020,25]octacosa-1(17),2,4(12),6,8,10,15,18(26),20,22,24-undecaene (PubChem CID 139196043) has the molecular formula C44H30B2N2O2S2 and a molecular weight of 704.49 g/mol. Its IUPAC name is 13,13,27,27-tetraphenyl-14,28-dioxa-5,19-dithia-12,26-diazonia-13,27-diboranuidaheptacyclo[15.11.0.03,15.04,12.06,11.018,26.020,25]octacosa-1(17),2,4(12),6,8,10,15,18(26),20,22,24-undecaene.
| Compound Name | 13,13,27,27-tetraphenyl-14,28-dioxa-5,19-dithia-12,26-diazonia-13,27-diboranuidaheptacyclo[15.11.0.03,15.04,12.06,11.018,26.020,25]octacosa-1(17),2,4(12),6,8,10,15,18(26),20,22,24-undecaene |
|---|---|
| PubChem CID | 139196043 |
| Molecular Formula | C44H30B2N2O2S2 |
| Molecular Weight | 704.49 g/mol |
| Exact Mass | 704.19 |
| IUPAC Name | 13,13,27,27-tetraphenyl-14,28-dioxa-5,19-dithia-12,26-diazonia-13,27-diboranuidaheptacyclo[15.11.0.03,15.04,12.06,11.018,26.020,25]octacosa-1(17),2,4(12),6,8,10,15,18(26),20,22,24-undecaene |
| SMILES | c1ccc([B-]2(c3ccccc3)Oc3cc4c(cc3-c3sc5ccccc5[n+]32)O[B-](c2ccccc2)(c2ccccc2)[n+]2c-4sc3ccccc32)cc1 |
| InChI | InChI=1S/C44H30B2N2O2S2/c1-5-17-31(18-6-1)45(32-19-7-2-8-20-32)47-37-25-13-15-27-41(37)51-43(47)35-30-40-36(29-39(35)49-45)44-48(38-26-14-16-28-42(38)52-44)46(50-40,33-21-9-3-10-22-33)34-23-11-4-12-24-34/h1-30H |
| InChIKey | IQAHFRZJRHFERU-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 26.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.49 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|