C19H16BrClN4O5S — CID 139198312
2-(5-bromothiophen-2-yl)-3H-imidazo[4,5-f][1,10]phenanthrolin-8-ium;ethanol;perchlorate (PubChem CID 139198312) has the molecular formula C19H16BrClN4O5S and a molecular weight of 527.78 g/mol. Its IUPAC name is 2-(5-bromothiophen-2-yl)-3H-imidazo[4,5-f][1,10]phenanthrolin-8-ium;ethanol;perchlorate.
| Compound Name | 2-(5-bromothiophen-2-yl)-3H-imidazo[4,5-f][1,10]phenanthrolin-8-ium;ethanol;perchlorate |
|---|---|
| PubChem CID | 139198312 |
| Molecular Formula | C19H16BrClN4O5S |
| Molecular Weight | 527.78 g/mol |
| Exact Mass | 525.97 |
| IUPAC Name | 2-(5-bromothiophen-2-yl)-3H-imidazo[4,5-f][1,10]phenanthrolin-8-ium;ethanol;perchlorate |
| SMILES | Brc1ccc(-c2nc3c4ccc[nH+]c4c4ncccc4c3[nH]2)s1.CCO.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C17H9BrN4S.C2H6O.ClHO4/c18-12-6-5-11(23-12)17-21-15-9-3-1-7-19-13(9)14-10(16(15)22-17)4-2-8-20-14;1-2-3;2-1(3,4)5/h1-8H,(H,21,22);3H,2H2,1H3;(H,2,3,4,5) |
| InChIKey | BUNGNFOZVWTVCX-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 168.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.78 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|