C19H22N4O7 — CID 139199663
methyl 6-[3-[(6-methoxycarbonylpyridine-2-carbonyl)amino]propylcarbamoyl]pyridine-2-carboxylate;hydrate (PubChem CID 139199663) has the molecular formula C19H22N4O7 and a molecular weight of 418.41 g/mol. Its IUPAC name is methyl 6-[3-[(6-methoxycarbonylpyridine-2-carbonyl)amino]propylcarbamoyl]pyridine-2-carboxylate;hydrate.
| Compound Name | methyl 6-[3-[(6-methoxycarbonylpyridine-2-carbonyl)amino]propylcarbamoyl]pyridine-2-carboxylate;hydrate |
|---|---|
| PubChem CID | 139199663 |
| Molecular Formula | C19H22N4O7 |
| Molecular Weight | 418.41 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | methyl 6-[3-[(6-methoxycarbonylpyridine-2-carbonyl)amino]propylcarbamoyl]pyridine-2-carboxylate;hydrate |
| SMILES | COC(=O)c1cccc(C(=O)NCCCNC(=O)c2cccc(C(=O)OC)n2)n1.O |
| InChI | InChI=1S/C19H20N4O6.H2O/c1-28-18(26)14-8-3-6-12(22-14)16(24)20-10-5-11-21-17(25)13-7-4-9-15(23-13)19(27)29-2;/h3-4,6-9H,5,10-11H2,1-2H3,(H,20,24)(H,21,25);1H2 |
| InChIKey | CIHKRIPXYBSQSF-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 168.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.41 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|