C34H40N2O8 — CID 139200651
5,18-bis(prop-2-enyl)-2,8,15,21-tetraoxa-5,18-diazatricyclo[20.4.0.09,14]hexacosa-1(26),9,11,13,22,24-hexaene;terephthalic acid (PubChem CID 139200651) has the molecular formula C34H40N2O8 and a molecular weight of 604.70 g/mol. Its IUPAC name is 5,18-bis(prop-2-enyl)-2,8,15,21-tetraoxa-5,18-diazatricyclo[20.4.0.09,14]hexacosa-1(26),9,11,13,22,24-hexaene;terephthalic acid.
| Compound Name | 5,18-bis(prop-2-enyl)-2,8,15,21-tetraoxa-5,18-diazatricyclo[20.4.0.09,14]hexacosa-1(26),9,11,13,22,24-hexaene;terephthalic acid |
|---|---|
| PubChem CID | 139200651 |
| Molecular Formula | C34H40N2O8 |
| Molecular Weight | 604.70 g/mol |
| Exact Mass | 604.28 |
| IUPAC Name | 5,18-bis(prop-2-enyl)-2,8,15,21-tetraoxa-5,18-diazatricyclo[20.4.0.09,14]hexacosa-1(26),9,11,13,22,24-hexaene;terephthalic acid |
| SMILES | C=CCN1CCOc2ccccc2OCCN(CC=C)CCOc2ccccc2OCC1.O=C(O)c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C26H34N2O4.C8H6O4/c1-3-13-27-15-19-29-23-9-5-7-11-25(23)31-21-17-28(14-4-2)18-22-32-26-12-8-6-10-24(26)30-20-16-27;9-7(10)5-1-2-6(4-3-5)8(11)12/h3-12H,1-2,13-22H2;1-4H,(H,9,10)(H,11,12) |
| InChIKey | HTIMQNCMWHVRHN-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 118.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.70 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|