C51H48N2O2S2 — CID 139200859
2-(1,3-benzothiazol-2-yl)-4-[7-[3-(1,3-benzothiazol-2-yl)-4-hydroxyphenyl]-9,9-dihexylfluoren-2-yl]phenol (PubChem CID 139200859) has the molecular formula C51H48N2O2S2 and a molecular weight of 785.09 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-yl)-4-[7-[3-(1,3-benzothiazol-2-yl)-4-hydroxyphenyl]-9,9-dihexylfluoren-2-yl]phenol.
| Compound Name | 2-(1,3-benzothiazol-2-yl)-4-[7-[3-(1,3-benzothiazol-2-yl)-4-hydroxyphenyl]-9,9-dihexylfluoren-2-yl]phenol |
|---|---|
| PubChem CID | 139200859 |
| Molecular Formula | C51H48N2O2S2 |
| Molecular Weight | 785.09 g/mol |
| Exact Mass | 784.32 |
| IUPAC Name | 2-(1,3-benzothiazol-2-yl)-4-[7-[3-(1,3-benzothiazol-2-yl)-4-hydroxyphenyl]-9,9-dihexylfluoren-2-yl]phenol |
| SMILES | CCCCCCC1(CCCCCC)c2cc(-c3ccc(O)c(-c4nc5ccccc5s4)c3)ccc2-c2ccc(-c3ccc(O)c(-c4nc5ccccc5s4)c3)cc21 |
| InChI | InChI=1S/C51H48N2O2S2/c1-3-5-7-13-27-51(28-14-8-6-4-2)41-31-35(33-21-25-45(54)39(29-33)49-52-43-15-9-11-17-47(43)56-49)19-23-37(41)38-24-20-36(32-42(38)51)34-22-26-46(55)40(30-34)50-53-44-16-10-12-18-48(44)57-50/h9-12,15-26,29-32,54-55H,3-8,13-14,27-28H2,1-2H3 |
| InChIKey | SXPGASKHULAHHW-UHFFFAOYSA-N |
| XLogP | 15.19 |
| TPSA | 66.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 785.09 |
| LogP ≤ 5 | 15.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|