C34H25N3O6 — CID 139200908
dimethyl (2S)-3,3-dicyano-2-[(E)-2-(3-methylphenyl)ethenyl]-1',3'-dioxo-1-phenylspiro[2H-pyridine-4,2'-indene]-5,6-dicarboxylate (PubChem CID 139200908) has the molecular formula C34H25N3O6 and a molecular weight of 571.59 g/mol. Its IUPAC name is dimethyl (2S)-3,3-dicyano-2-[(E)-2-(3-methylphenyl)ethenyl]-1',3'-dioxo-1-phenylspiro[2H-pyridine-4,2'-indene]-5,6-dicarboxylate.
| Compound Name | dimethyl (2S)-3,3-dicyano-2-[(E)-2-(3-methylphenyl)ethenyl]-1',3'-dioxo-1-phenylspiro[2H-pyridine-4,2'-indene]-5,6-dicarboxylate |
|---|---|
| PubChem CID | 139200908 |
| Molecular Formula | C34H25N3O6 |
| Molecular Weight | 571.59 g/mol |
| Exact Mass | 571.17 |
| IUPAC Name | dimethyl (2S)-3,3-dicyano-2-[(E)-2-(3-methylphenyl)ethenyl]-1',3'-dioxo-1-phenylspiro[2H-pyridine-4,2'-indene]-5,6-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)C2(C(=O)c3ccccc3C2=O)C(C#N)(C#N)[C@H](/C=C/c2cccc(C)c2)N1c1ccccc1 |
| InChI | InChI=1S/C34H25N3O6/c1-21-10-9-11-22(18-21)16-17-26-33(19-35,20-36)34(29(38)24-14-7-8-15-25(24)30(34)39)27(31(40)42-2)28(32(41)43-3)37(26)23-12-5-4-6-13-23/h4-18,26H,1-3H3/b17-16+/t26-/m0/s1 |
| InChIKey | DSNLYYTYBUVCCT-ZOGILVBSSA-N |
| XLogP | 4.60 |
| TPSA | 137.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.59 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|