C24H17N3O2S — CID 139201280
(2Z)-2-[(6R)-6-hydroxy-2,6-diphenyl-[1,3]thiazolo[3,2-b][1,2,4]triazol-5-ylidene]-1-phenylethanone (PubChem CID 139201280) has the molecular formula C24H17N3O2S and a molecular weight of 411.49 g/mol. Its IUPAC name is (2Z)-2-[(6R)-6-hydroxy-2,6-diphenyl-[1,3]thiazolo[3,2-b][1,2,4]triazol-5-ylidene]-1-phenylethanone.
| Compound Name | (2Z)-2-[(6R)-6-hydroxy-2,6-diphenyl-[1,3]thiazolo[3,2-b][1,2,4]triazol-5-ylidene]-1-phenylethanone |
|---|---|
| PubChem CID | 139201280 |
| Molecular Formula | C24H17N3O2S |
| Molecular Weight | 411.49 g/mol |
| Exact Mass | 411.10 |
| IUPAC Name | (2Z)-2-[(6R)-6-hydroxy-2,6-diphenyl-[1,3]thiazolo[3,2-b][1,2,4]triazol-5-ylidene]-1-phenylethanone |
| SMILES | O=C(/C=C1\Sc2nc(-c3ccccc3)nn2[C@@]1(O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H17N3O2S/c28-20(17-10-4-1-5-11-17)16-21-24(29,19-14-8-3-9-15-19)27-23(30-21)25-22(26-27)18-12-6-2-7-13-18/h1-16,29H/b21-16-/t24-/m1/s1 |
| InChIKey | GUBWWGNMLDFKKV-OFVJEAJMSA-N |
| XLogP | 4.51 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.49 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|