C20H14N4O2Pd — CID 139205858
palladium(2+);bis(pyridin-2-yl(pyrrol-1-id-2-yl)methanone) (PubChem CID 139205858) has the molecular formula C20H14N4O2Pd and a molecular weight of 448.78 g/mol. Its IUPAC name is palladium(2+);bis(pyridin-2-yl(pyrrol-1-id-2-yl)methanone).
| Compound Name | palladium(2+);bis(pyridin-2-yl(pyrrol-1-id-2-yl)methanone) |
|---|---|
| PubChem CID | 139205858 |
| Molecular Formula | C20H14N4O2Pd |
| Molecular Weight | 448.78 g/mol |
| Exact Mass | 448.02 |
| IUPAC Name | palladium(2+);bis(pyridin-2-yl(pyrrol-1-id-2-yl)methanone) |
| SMILES | O=C(c1ccccn1)c1ccc[n-]1.O=C(c1ccccn1)c1ccc[n-]1.[Pd+2] |
| InChI | InChI=1S/2C10H8N2O.Pd/c2*13-10(9-5-3-7-12-9)8-4-1-2-6-11-8;/h2*1-7H,(H,12,13);/q;;+2/p-2 |
| InChIKey | PHQTZLYOGZGVTM-UHFFFAOYSA-L |
| XLogP | 2.54 |
| TPSA | 88.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.78 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |