C36H26N8S4 — CID 139206240
4-methyl-5-[5-[[5-(4-methyl-2-phenyl-1,3-thiazol-5-yl)-4-phenyl-1,2,4-triazol-3-yl]disulfanyl]-4-phenyl-1,2,4-triazol-3-yl]-2-phenyl-1,3-thiazole (PubChem CID 139206240) has the molecular formula C36H26N8S4 and a molecular weight of 698.93 g/mol. Its IUPAC name is 4-methyl-5-[5-[[5-(4-methyl-2-phenyl-1,3-thiazol-5-yl)-4-phenyl-1,2,4-triazol-3-yl]disulfanyl]-4-phenyl-1,2,4-triazol-3-yl]-2-phenyl-1,3-thiazole.
| Compound Name | 4-methyl-5-[5-[[5-(4-methyl-2-phenyl-1,3-thiazol-5-yl)-4-phenyl-1,2,4-triazol-3-yl]disulfanyl]-4-phenyl-1,2,4-triazol-3-yl]-2-phenyl-1,3-thiazole |
|---|---|
| PubChem CID | 139206240 |
| Molecular Formula | C36H26N8S4 |
| Molecular Weight | 698.93 g/mol |
| Exact Mass | 698.12 |
| IUPAC Name | 4-methyl-5-[5-[[5-(4-methyl-2-phenyl-1,3-thiazol-5-yl)-4-phenyl-1,2,4-triazol-3-yl]disulfanyl]-4-phenyl-1,2,4-triazol-3-yl]-2-phenyl-1,3-thiazole |
| SMILES | Cc1nc(-c2ccccc2)sc1-c1nnc(SSc2nnc(-c3sc(-c4ccccc4)nc3C)n2-c2ccccc2)n1-c1ccccc1 |
| InChI | InChI=1S/C36H26N8S4/c1-23-29(45-33(37-23)25-15-7-3-8-16-25)31-39-41-35(43(31)27-19-11-5-12-20-27)47-48-36-42-40-32(44(36)28-21-13-6-14-22-28)30-24(2)38-34(46-30)26-17-9-4-10-18-26/h3-22H,1-2H3 |
| InChIKey | RKCYYGSYGUXGAN-UHFFFAOYSA-N |
| XLogP | 9.85 |
| TPSA | 87.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.93 |
| LogP ≤ 5 | 9.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|