C20H13Cl4N3O2S — CID 139207229
(1R,11Z)-4-(2,6-dichlorophenyl)-11-[(2,4-dichlorophenyl)methylidene]-2-oxa-12-thia-3,5,9-triazatricyclo[7.3.0.01,5]dodec-3-en-10-one (PubChem CID 139207229) has the molecular formula C20H13Cl4N3O2S and a molecular weight of 501.22 g/mol. Its IUPAC name is (1R,11Z)-4-(2,6-dichlorophenyl)-11-[(2,4-dichlorophenyl)methylidene]-2-oxa-12-thia-3,5,9-triazatricyclo[7.3.0.01,5]dodec-3-en-10-one.
| Compound Name | (1R,11Z)-4-(2,6-dichlorophenyl)-11-[(2,4-dichlorophenyl)methylidene]-2-oxa-12-thia-3,5,9-triazatricyclo[7.3.0.01,5]dodec-3-en-10-one |
|---|---|
| PubChem CID | 139207229 |
| Molecular Formula | C20H13Cl4N3O2S |
| Molecular Weight | 501.22 g/mol |
| Exact Mass | 498.95 |
| IUPAC Name | (1R,11Z)-4-(2,6-dichlorophenyl)-11-[(2,4-dichlorophenyl)methylidene]-2-oxa-12-thia-3,5,9-triazatricyclo[7.3.0.01,5]dodec-3-en-10-one |
| SMILES | O=C1/C(=C/c2ccc(Cl)cc2Cl)S[C@]23ON=C(c4c(Cl)cccc4Cl)N2CCCN13 |
| InChI | InChI=1S/C20H13Cl4N3O2S/c21-12-6-5-11(15(24)10-12)9-16-19(28)27-8-2-7-26-18(25-29-20(26,27)30-16)17-13(22)3-1-4-14(17)23/h1,3-6,9-10H,2,7-8H2/b16-9-/t20-/m1/s1 |
| InChIKey | RCSMBQRSXNNECV-SIBGDRKGSA-N |
| XLogP | 5.93 |
| TPSA | 45.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.22 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|