C19H30N8O4 — CID 139212307
1-(2-ethylbutyl)-3-(4-methyl-6-oxo-1H-pyrimidin-2-yl)urea;1-methyl-3-(4-methyl-6-oxo-1H-pyrimidin-2-yl)urea (PubChem CID 139212307) has the molecular formula C19H30N8O4 and a molecular weight of 434.50 g/mol. Its IUPAC name is 1-(2-ethylbutyl)-3-(4-methyl-6-oxo-1H-pyrimidin-2-yl)urea;1-methyl-3-(4-methyl-6-oxo-1H-pyrimidin-2-yl)urea.
| Compound Name | 1-(2-ethylbutyl)-3-(4-methyl-6-oxo-1H-pyrimidin-2-yl)urea;1-methyl-3-(4-methyl-6-oxo-1H-pyrimidin-2-yl)urea |
|---|---|
| PubChem CID | 139212307 |
| Molecular Formula | C19H30N8O4 |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.24 |
| IUPAC Name | 1-(2-ethylbutyl)-3-(4-methyl-6-oxo-1H-pyrimidin-2-yl)urea;1-methyl-3-(4-methyl-6-oxo-1H-pyrimidin-2-yl)urea |
| SMILES | CCC(CC)CNC(=O)Nc1nc(C)cc(=O)[nH]1.CNC(=O)Nc1nc(C)cc(=O)[nH]1 |
| InChI | InChI=1S/C12H20N4O2.C7H10N4O2/c1-4-9(5-2)7-13-12(18)16-11-14-8(3)6-10(17)15-11;1-4-3-5(12)10-6(9-4)11-7(13)8-2/h6,9H,4-5,7H2,1-3H3,(H3,13,14,15,16,17,18);3H,1-2H3,(H3,8,9,10,11,12,13) |
| InChIKey | XLMDRFAVFJUFLJ-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 173.76 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |