C76H144N8O4 — CID 139249161
1-[11-methyl-8-(3-methylbutyl)-4-[7-methyl-4-(3-methylbutyl)octyl]dodecyl]-3-(4-methyl-6-oxo-1H-pyrimidin-2-yl)urea (PubChem CID 139249161) has the molecular formula C76H144N8O4 and a molecular weight of 1234.04 g/mol. Its IUPAC name is 1-[11-methyl-8-(3-methylbutyl)-4-[7-methyl-4-(3-methylbutyl)octyl]dodecyl]-3-(4-methyl-6-oxo-1H-pyrimidin-2-yl)urea.
| Compound Name | 1-[11-methyl-8-(3-methylbutyl)-4-[7-methyl-4-(3-methylbutyl)octyl]dodecyl]-3-(4-methyl-6-oxo-1H-pyrimidin-2-yl)urea |
|---|---|
| PubChem CID | 139249161 |
| Molecular Formula | C76H144N8O4 |
| Molecular Weight | 1234.04 g/mol |
| Exact Mass | 1233.13 |
| IUPAC Name | 1-[11-methyl-8-(3-methylbutyl)-4-[7-methyl-4-(3-methylbutyl)octyl]dodecyl]-3-(4-methyl-6-oxo-1H-pyrimidin-2-yl)urea |
| SMILES | Cc1cc(=O)[nH]c(NC(=O)NCCCC(CCCC(CCC(C)C)CCC(C)C)CCCC(CCC(C)C)CCC(C)C)n1.Cc1cc(=O)[nH]c(NC(=O)NCCCC(CCCC(CCC(C)C)CCC(C)C)CCCC(CCC(C)C)CCC(C)C)n1 |
| InChI | InChI=1S/2C38H72N4O2/c2*1-28(2)18-22-34(23-19-29(3)4)15-10-13-33(14-11-16-35(24-20-30(5)6)25-21-31(7)8)17-12-26-39-38(44)42-37-40-32(9)27-36(43)41-37/h2*27-31,33-35H,10-26H2,1-9H3,(H3,39,40,41,42,43,44) |
| InChIKey | XFGLMVIGFVBEOB-UHFFFAOYSA-N |
| XLogP | 21.83 |
| TPSA | 173.76 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 50 |
| Heavy Atoms | 88 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1234.04 |
| LogP ≤ 5 | 21.83 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|