C40H72N8O4 — CID 139249159
1-[7-methyl-4-(3-methylbutyl)octyl]-3-(4-methyl-6-oxo-1H-pyrimidin-2-yl)urea (PubChem CID 139249159) has the molecular formula C40H72N8O4 and a molecular weight of 729.07 g/mol. Its IUPAC name is 1-[7-methyl-4-(3-methylbutyl)octyl]-3-(4-methyl-6-oxo-1H-pyrimidin-2-yl)urea.
| Compound Name | 1-[7-methyl-4-(3-methylbutyl)octyl]-3-(4-methyl-6-oxo-1H-pyrimidin-2-yl)urea |
|---|---|
| PubChem CID | 139249159 |
| Molecular Formula | C40H72N8O4 |
| Molecular Weight | 729.07 g/mol |
| Exact Mass | 728.57 |
| IUPAC Name | 1-[7-methyl-4-(3-methylbutyl)octyl]-3-(4-methyl-6-oxo-1H-pyrimidin-2-yl)urea |
| SMILES | Cc1cc(=O)[nH]c(NC(=O)NCCCC(CCC(C)C)CCC(C)C)n1.Cc1cc(=O)[nH]c(NC(=O)NCCCC(CCC(C)C)CCC(C)C)n1 |
| InChI | InChI=1S/2C20H36N4O2/c2*1-14(2)8-10-17(11-9-15(3)4)7-6-12-21-20(26)24-19-22-16(5)13-18(25)23-19/h2*13-15,17H,6-12H2,1-5H3,(H3,21,22,23,24,25,26) |
| InChIKey | AJQWLCZLBLQQPA-UHFFFAOYSA-N |
| XLogP | 8.94 |
| TPSA | 173.76 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.07 |
| LogP ≤ 5 | 8.94 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|