C26H19F3O4S — CID 139213140
(9,10-dioxoanthracen-2-yl)methyl 2-[[3-(2,2,2-trifluoroethyl)phenyl]methylsulfanyl]acetate (PubChem CID 139213140) has the molecular formula C26H19F3O4S and a molecular weight of 484.50 g/mol. Its IUPAC name is (9,10-dioxoanthracen-2-yl)methyl 2-[[3-(2,2,2-trifluoroethyl)phenyl]methylsulfanyl]acetate.
| Compound Name | (9,10-dioxoanthracen-2-yl)methyl 2-[[3-(2,2,2-trifluoroethyl)phenyl]methylsulfanyl]acetate |
|---|---|
| PubChem CID | 139213140 |
| Molecular Formula | C26H19F3O4S |
| Molecular Weight | 484.50 g/mol |
| Exact Mass | 484.10 |
| IUPAC Name | (9,10-dioxoanthracen-2-yl)methyl 2-[[3-(2,2,2-trifluoroethyl)phenyl]methylsulfanyl]acetate |
| SMILES | O=C(CSCc1cccc(CC(F)(F)F)c1)OCc1ccc2c(c1)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C26H19F3O4S/c27-26(28,29)12-16-4-3-5-18(10-16)14-34-15-23(30)33-13-17-8-9-21-22(11-17)25(32)20-7-2-1-6-19(20)24(21)31/h1-11H,12-15H2 |
| InChIKey | RYEQQXJZLGGDAZ-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.50 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|