C29H46N14O5 — CID 139213424
3-(6-aminopurin-9-yl)-N-[2-[2-[2-(dimethylamino)ethoxy]ethoxy]ethyl]propanamide;3-(6-aminopurin-9-yl)-N-(4-formamidobutyl)propanamide (PubChem CID 139213424) has the molecular formula C29H46N14O5 and a molecular weight of 670.78 g/mol. Its IUPAC name is 3-(6-aminopurin-9-yl)-N-[2-[2-[2-(dimethylamino)ethoxy]ethoxy]ethyl]propanamide;3-(6-aminopurin-9-yl)-N-(4-formamidobutyl)propanamide.
| Compound Name | 3-(6-aminopurin-9-yl)-N-[2-[2-[2-(dimethylamino)ethoxy]ethoxy]ethyl]propanamide;3-(6-aminopurin-9-yl)-N-(4-formamidobutyl)propanamide |
|---|---|
| PubChem CID | 139213424 |
| Molecular Formula | C29H46N14O5 |
| Molecular Weight | 670.78 g/mol |
| Exact Mass | 670.38 |
| IUPAC Name | 3-(6-aminopurin-9-yl)-N-[2-[2-[2-(dimethylamino)ethoxy]ethoxy]ethyl]propanamide;3-(6-aminopurin-9-yl)-N-(4-formamidobutyl)propanamide |
| SMILES | CN(C)CCOCCOCCNC(=O)CCn1cnc2c(N)ncnc21.Nc1ncnc2c1ncn2CCC(=O)NCCCCNC=O |
| InChI | InChI=1S/C16H27N7O3.C13H19N7O2/c1-22(2)6-8-26-10-9-25-7-4-18-13(24)3-5-23-12-21-14-15(17)19-11-20-16(14)23;14-12-11-13(18-7-17-12)20(8-19-11)6-3-10(22)16-5-2-1-4-15-9-21/h11-12H,3-10H2,1-2H3,(H,18,24)(H2,17,19,20);7-9H,1-6H2,(H,15,21)(H,16,22)(H2,14,17,18) |
| InChIKey | LUMRYMJFGFJPSL-UHFFFAOYSA-N |
| XLogP | -1.05 |
| TPSA | 248.24 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.78 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|