C51H41N5O — CID 139213613
2,2-dimethyl-5-[4-(10,15,20-triphenyl-21,23-dihydroporphyrin-5-yl)phenoxy]pentanenitrile (PubChem CID 139213613) has the molecular formula C51H41N5O and a molecular weight of 739.92 g/mol. Its IUPAC name is 2,2-dimethyl-5-[4-(10,15,20-triphenyl-21,23-dihydroporphyrin-5-yl)phenoxy]pentanenitrile.
| Compound Name | 2,2-dimethyl-5-[4-(10,15,20-triphenyl-21,23-dihydroporphyrin-5-yl)phenoxy]pentanenitrile |
|---|---|
| PubChem CID | 139213613 |
| Molecular Formula | C51H41N5O |
| Molecular Weight | 739.92 g/mol |
| Exact Mass | 739.33 |
| IUPAC Name | 2,2-dimethyl-5-[4-(10,15,20-triphenyl-21,23-dihydroporphyrin-5-yl)phenoxy]pentanenitrile |
| SMILES | CC(C)(C#N)CCCOc1ccc(-c2c3nc(c(-c4ccccc4)c4ccc([nH]4)c(-c4ccccc4)c4nc(c(-c5ccccc5)c5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C51H41N5O/c1-51(2,33-52)31-12-32-57-38-21-19-37(20-22-38)50-45-29-27-43(55-45)48(35-15-8-4-9-16-35)41-25-23-39(53-41)47(34-13-6-3-7-14-34)40-24-26-42(54-40)49(36-17-10-5-11-18-36)44-28-30-46(50)56-44/h3-11,13-30,53,56H,12,31-32H2,1-2H3/b47-39-,47-40-,48-41-,48-43-,49-42-,49-44-,50-45-,50-46- |
| InChIKey | BBOLZGHVLITLIT-VZQFQVGISA-N |
| XLogP | 13.03 |
| TPSA | 90.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 739.92 |
| LogP ≤ 5 | 13.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|