About dimethyl (Z)-2-[(E)-N'-[(E)-1-pyridin-3-ylethylideneamino]carbamimidoyl]sulfanylbut-2-enedioate
dimethyl (Z)-2-[(E)-N'-[(E)-1-pyridin-3-ylethylideneamino]carbamimidoyl]sulfanylbut-2-enedioate (PubChem CID 139214759) has the molecular formula C14H16N4O4S
and a molecular weight of 336.37 g/mol. Its IUPAC name is dimethyl (Z)-2-[(E)-N'-[(E)-1-pyridin-3-ylethylideneamino]carbamimidoyl]sulfanylbut-2-enedioate.
Molecular Properties
| Compound Name | dimethyl (Z)-2-[(E)-N'-[(E)-1-pyridin-3-ylethylideneamino]carbamimidoyl]sulfanylbut-2-enedioate |
| PubChem CID | 139214759 |
| Molecular Formula | C14H16N4O4S |
| Molecular Weight | 336.37 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | dimethyl (Z)-2-[(E)-N'-[(E)-1-pyridin-3-ylethylideneamino]carbamimidoyl]sulfanylbut-2-enedioate |
| SMILES | COC(=O)/C=C(\S/C(N)=N/N=C(\C)c1cccnc1)C(=O)OC |
| InChI | InChI=1S/C14H16N4O4S/c1-9(10-5-4-6-16-8-10)17-18-14(15)23-11(13(20)22-3)7-12(19)21-2/h4-8H,1-3H3,(H2,15,18)/b11-7-,17-9+ |
| InChIKey | QMVWEOKMSSTGOI-MJLVTURWSA-N |
| XLogP | 1.08 |
| TPSA | 116.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.37 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze dimethyl (Z)-2-[(E)-N'-[(E)-1-pyridin-3-ylethylideneamino]carbamimidoyl]sulfanylbut-2-enedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl (Z)-2-[(E)-N'-[(E)-1-pyridin-3-ylethylideneamino]carbamimidoyl]sulfanylbut-2-enedioate?
The IUPAC name of dimethyl (Z)-2-[(E)-N'-[(E)-1-pyridin-3-ylethylideneamino]carbamimidoyl]sulfanylbut-2-enedioate (CID 139214759) is dimethyl (Z)-2-[(E)-N'-[(E)-1-pyridin-3-ylethylideneamino]carbamimidoyl]sulfanylbut-2-enedioate.
What is the SMILES notation for dimethyl (Z)-2-[(E)-N'-[(E)-1-pyridin-3-ylethylideneamino]carbamimidoyl]sulfanylbut-2-enedioate?
The canonical SMILES for dimethyl (Z)-2-[(E)-N'-[(E)-1-pyridin-3-ylethylideneamino]carbamimidoyl]sulfanylbut-2-enedioate is COC(=O)/C=C(\S/C(N)=N/N=C(\C)c1cccnc1)C(=O)OC.
What is the InChIKey of dimethyl (Z)-2-[(E)-N'-[(E)-1-pyridin-3-ylethylideneamino]carbamimidoyl]sulfanylbut-2-enedioate?
The InChIKey is QMVWEOKMSSTGOI-MJLVTURWSA-N. The full InChI is InChI=1S/C14H16N4O4S/c1-9(10-5-4-6-16-8-10)17-18-14(15)23-11(13(20)22-3)7-12(19)21-2/h4-8H,1-3H3,(H2,15,18)/b11-7-,17-9+.
What are the key properties of dimethyl (Z)-2-[(E)-N'-[(E)-1-pyridin-3-ylethylideneamino]carbamimidoyl]sulfanylbut-2-enedioate?
dimethyl (Z)-2-[(E)-N'-[(E)-1-pyridin-3-ylethylideneamino]carbamimidoyl]sulfanylbut-2-enedioate has a molecular weight of 336.37 g/mol, XLogP of 1.08, 5 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl (Z)-2-[(E)-N'-[(E)-1-pyridin-3-ylethylideneamino]carbamimidoyl]sulfanylbut-2-enedioate is sourced from PubChem (CID 139214759), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).