C21H19N3O — CID 139214982
16-(3,4-dimethylphenyl)-3,4,10-triazatetracyclo[7.7.0.02,6.011,15]hexadeca-1(9),2(6),4,7,11(15)-pentaen-14-one (PubChem CID 139214982) has the molecular formula C21H19N3O and a molecular weight of 329.40 g/mol. Its IUPAC name is 16-(3,4-dimethylphenyl)-3,4,10-triazatetracyclo[7.7.0.02,6.011,15]hexadeca-1(9),2(6),4,7,11(15)-pentaen-14-one.
| Compound Name | 16-(3,4-dimethylphenyl)-3,4,10-triazatetracyclo[7.7.0.02,6.011,15]hexadeca-1(9),2(6),4,7,11(15)-pentaen-14-one |
|---|---|
| PubChem CID | 139214982 |
| Molecular Formula | C21H19N3O |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.15 |
| IUPAC Name | 16-(3,4-dimethylphenyl)-3,4,10-triazatetracyclo[7.7.0.02,6.011,15]hexadeca-1(9),2(6),4,7,11(15)-pentaen-14-one |
| SMILES | Cc1ccc(C2C3=C(CCC3=O)Nc3ccc4cn[nH]c4c32)cc1C |
| InChI | InChI=1S/C21H19N3O/c1-11-3-4-13(9-12(11)2)18-19-15(7-8-17(19)25)23-16-6-5-14-10-22-24-21(14)20(16)18/h3-6,9-10,18,23H,7-8H2,1-2H3,(H,22,24) |
| InChIKey | IUGJREMNGWFPHX-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |