C11H14Cl2Mg2N2O3 — CID 139215023
dimagnesium;5-[cyclohexyl(hydroxy)methyl]pyrimidine-2,4-diolate;dichloride (PubChem CID 139215023) has the molecular formula C11H14Cl2Mg2N2O3 and a molecular weight of 341.76 g/mol. Its IUPAC name is dimagnesium;5-[cyclohexyl(hydroxy)methyl]pyrimidine-2,4-diolate;dichloride.
| Compound Name | dimagnesium;5-[cyclohexyl(hydroxy)methyl]pyrimidine-2,4-diolate;dichloride |
|---|---|
| PubChem CID | 139215023 |
| Molecular Formula | C11H14Cl2Mg2N2O3 |
| Molecular Weight | 341.76 g/mol |
| Exact Mass | 340.01 |
| IUPAC Name | dimagnesium;5-[cyclohexyl(hydroxy)methyl]pyrimidine-2,4-diolate;dichloride |
| SMILES | [Cl-].[Cl-].[Mg+2].[Mg+2].[O-]c1ncc(C(O)C2CCCCC2)c([O-])n1 |
| InChI | InChI=1S/C11H16N2O3.2ClH.2Mg/c14-9(7-4-2-1-3-5-7)8-6-12-11(16)13-10(8)15;;;;/h6-7,9,14H,1-5H2,(H2,12,13,15,16);2*1H;;/q;;;2*+2/p-4 |
| InChIKey | GAVREBIZKUZROR-UHFFFAOYSA-J |
| XLogP | -6.52 |
| TPSA | 92.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.76 |
| LogP ≤ 5 | -6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |