C10H14INOS — CID 130541405
cyclohexyl-(5-iodo-1,3-thiazol-2-yl)methanol (PubChem CID 130541405) has the molecular formula C10H14INOS and a molecular weight of 323.20 g/mol. Its IUPAC name is cyclohexyl-(5-iodo-1,3-thiazol-2-yl)methanol.
| Compound Name | cyclohexyl-(5-iodo-1,3-thiazol-2-yl)methanol |
|---|---|
| PubChem CID | 130541405 |
| Molecular Formula | C10H14INOS |
| Molecular Weight | 323.20 g/mol |
| Exact Mass | 322.98 |
| IUPAC Name | cyclohexyl-(5-iodo-1,3-thiazol-2-yl)methanol |
| SMILES | OC(c1ncc(I)s1)C1CCCCC1 |
| InChI | InChI=1S/C10H14INOS/c11-8-6-12-10(14-8)9(13)7-4-2-1-3-5-7/h6-7,9,13H,1-5H2 |
| InChIKey | DWTODUPWDRZZKD-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.20 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|