C6H6INS — CID 126976994
2-cyclopropyl-5-iodo-1,3-thiazole (PubChem CID 126976994) has the molecular formula C6H6INS and a molecular weight of 251.09 g/mol. Its IUPAC name is 2-cyclopropyl-5-iodo-1,3-thiazole.
| Compound Name | 2-cyclopropyl-5-iodo-1,3-thiazole |
|---|---|
| PubChem CID | 126976994 |
| Molecular Formula | C6H6INS |
| Molecular Weight | 251.09 g/mol |
| Exact Mass | 250.93 |
| IUPAC Name | 2-cyclopropyl-5-iodo-1,3-thiazole |
| SMILES | Ic1cnc(C2CC2)s1 |
| InChI | InChI=1S/C6H6INS/c7-5-3-8-6(9-5)4-1-2-4/h3-4H,1-2H2 |
| InChIKey | NGWFJJBWKKJQCA-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.09 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|