C6H6ClNO2S2 — CID 122163904
2-cyclopropyl-1,3-thiazole-5-sulfonyl chloride (PubChem CID 122163904) has the molecular formula C6H6ClNO2S2 and a molecular weight of 223.71 g/mol. Its IUPAC name is 2-cyclopropyl-1,3-thiazole-5-sulfonyl chloride.
| Compound Name | 2-cyclopropyl-1,3-thiazole-5-sulfonyl chloride |
|---|---|
| PubChem CID | 122163904 |
| Molecular Formula | C6H6ClNO2S2 |
| Molecular Weight | 223.71 g/mol |
| Exact Mass | 222.95 |
| IUPAC Name | 2-cyclopropyl-1,3-thiazole-5-sulfonyl chloride |
| SMILES | O=S(=O)(Cl)c1cnc(C2CC2)s1 |
| InChI | InChI=1S/C6H6ClNO2S2/c7-12(9,10)5-3-8-6(11-5)4-1-2-4/h3-4H,1-2H2 |
| InChIKey | WBZWPZZUWVCREP-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.71 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |