About 2-cyclopropyl-1,3-thiazole-5-sulfinic acid
2-cyclopropyl-1,3-thiazole-5-sulfinic acid (PubChem CID 165456056) has the molecular formula C6H7NO2S2
and a molecular weight of 189.26 g/mol. Its IUPAC name is 2-cyclopropyl-1,3-thiazole-5-sulfinic acid.
Molecular Properties
| Compound Name | 2-cyclopropyl-1,3-thiazole-5-sulfinic acid |
| PubChem CID | 165456056 |
| Molecular Formula | C6H7NO2S2 |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 188.99 |
| IUPAC Name | 2-cyclopropyl-1,3-thiazole-5-sulfinic acid |
| SMILES | O=S(O)c1cnc(C2CC2)s1 |
| InChI | InChI=1S/C6H7NO2S2/c8-11(9)5-3-7-6(10-5)4-1-2-4/h3-4H,1-2H2,(H,8,9) |
| InChIKey | XPCWZQHOEGZSCE-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze 2-cyclopropyl-1,3-thiazole-5-sulfinic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopropyl-1,3-thiazole-5-sulfinic acid?
The IUPAC name of 2-cyclopropyl-1,3-thiazole-5-sulfinic acid (CID 165456056) is 2-cyclopropyl-1,3-thiazole-5-sulfinic acid.
What is the SMILES notation for 2-cyclopropyl-1,3-thiazole-5-sulfinic acid?
The canonical SMILES for 2-cyclopropyl-1,3-thiazole-5-sulfinic acid is O=S(O)c1cnc(C2CC2)s1.
What is the InChIKey of 2-cyclopropyl-1,3-thiazole-5-sulfinic acid?
The InChIKey is XPCWZQHOEGZSCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7NO2S2/c8-11(9)5-3-7-6(10-5)4-1-2-4/h3-4H,1-2H2,(H,8,9).
What are the key properties of 2-cyclopropyl-1,3-thiazole-5-sulfinic acid?
2-cyclopropyl-1,3-thiazole-5-sulfinic acid has a molecular weight of 189.26 g/mol, XLogP of 1.60, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopropyl-1,3-thiazole-5-sulfinic acid is sourced from PubChem (CID 165456056), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).