C22H19N3O2S — CID 139216763
2-[(E)-C-ethyl-N-[[4-(4-methylphenyl)-1,3-thiazol-2-yl]amino]carbonimidoyl]indene-1,3-dione (PubChem CID 139216763) has the molecular formula C22H19N3O2S and a molecular weight of 389.48 g/mol. Its IUPAC name is 2-[(E)-C-ethyl-N-[[4-(4-methylphenyl)-1,3-thiazol-2-yl]amino]carbonimidoyl]indene-1,3-dione.
| Compound Name | 2-[(E)-C-ethyl-N-[[4-(4-methylphenyl)-1,3-thiazol-2-yl]amino]carbonimidoyl]indene-1,3-dione |
|---|---|
| PubChem CID | 139216763 |
| Molecular Formula | C22H19N3O2S |
| Molecular Weight | 389.48 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | 2-[(E)-C-ethyl-N-[[4-(4-methylphenyl)-1,3-thiazol-2-yl]amino]carbonimidoyl]indene-1,3-dione |
| SMILES | CC/C(=N\Nc1nc(-c2ccc(C)cc2)cs1)C1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C22H19N3O2S/c1-3-17(19-20(26)15-6-4-5-7-16(15)21(19)27)24-25-22-23-18(12-28-22)14-10-8-13(2)9-11-14/h4-12,19H,3H2,1-2H3,(H,23,25)/b24-17+ |
| InChIKey | MECCGFVZVQYHJM-JJIBRWJFSA-N |
| XLogP | 4.99 |
| TPSA | 71.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.48 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|