C19H19N3O4S — CID 139218440
methyl (2E)-2-[3-[(E)-[(E)-3-(2-methoxyphenyl)prop-2-enylidene]amino]-5-oxo-2-prop-2-enylimino-1,3-thiazolidin-4-ylidene]acetate (PubChem CID 139218440) has the molecular formula C19H19N3O4S and a molecular weight of 385.45 g/mol. Its IUPAC name is methyl (2E)-2-[3-[(E)-[(E)-3-(2-methoxyphenyl)prop-2-enylidene]amino]-5-oxo-2-prop-2-enylimino-1,3-thiazolidin-4-ylidene]acetate.
| Compound Name | methyl (2E)-2-[3-[(E)-[(E)-3-(2-methoxyphenyl)prop-2-enylidene]amino]-5-oxo-2-prop-2-enylimino-1,3-thiazolidin-4-ylidene]acetate |
|---|---|
| PubChem CID | 139218440 |
| Molecular Formula | C19H19N3O4S |
| Molecular Weight | 385.45 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | methyl (2E)-2-[3-[(E)-[(E)-3-(2-methoxyphenyl)prop-2-enylidene]amino]-5-oxo-2-prop-2-enylimino-1,3-thiazolidin-4-ylidene]acetate |
| SMILES | C=CC/N=C1\SC(=O)/C(=C\C(=O)OC)N1/N=C/C=C/c1ccccc1OC |
| InChI | InChI=1S/C19H19N3O4S/c1-4-11-20-19-22(15(18(24)27-19)13-17(23)26-3)21-12-7-9-14-8-5-6-10-16(14)25-2/h4-10,12-13H,1,11H2,2-3H3/b9-7+,15-13+,20-19-,21-12+ |
| InChIKey | GGPUTLOPXFBFNK-CPOVIBHGSA-N |
| XLogP | 2.87 |
| TPSA | 80.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.45 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|