C15H21NOS — CID 139218762
4-phenyl-2,6-di(propan-2-yl)-6H-1,3,5-oxathiazine (PubChem CID 139218762) has the molecular formula C15H21NOS and a molecular weight of 263.41 g/mol. Its IUPAC name is 4-phenyl-2,6-di(propan-2-yl)-6H-1,3,5-oxathiazine.
| Compound Name | 4-phenyl-2,6-di(propan-2-yl)-6H-1,3,5-oxathiazine |
|---|---|
| PubChem CID | 139218762 |
| Molecular Formula | C15H21NOS |
| Molecular Weight | 263.41 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | 4-phenyl-2,6-di(propan-2-yl)-6H-1,3,5-oxathiazine |
| SMILES | CC(C)C1N=C(c2ccccc2)SC(C(C)C)O1 |
| InChI | InChI=1S/C15H21NOS/c1-10(2)13-16-14(12-8-6-5-7-9-12)18-15(17-13)11(3)4/h5-11,13,15H,1-4H3 |
| InChIKey | GKZFLOHMSLAEGD-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.41 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |