C16H17ClN4O4 — CID 139219803
ethyl 3-[(2Z)-2-(1-chloro-2-ethoxy-2-oxoethylidene)hydrazinyl]-5-phenyl-1H-pyrazole-4-carboxylate (PubChem CID 139219803) has the molecular formula C16H17ClN4O4 and a molecular weight of 364.79 g/mol. Its IUPAC name is ethyl 3-[(2Z)-2-(1-chloro-2-ethoxy-2-oxoethylidene)hydrazinyl]-5-phenyl-1H-pyrazole-4-carboxylate.
| Compound Name | ethyl 3-[(2Z)-2-(1-chloro-2-ethoxy-2-oxoethylidene)hydrazinyl]-5-phenyl-1H-pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 139219803 |
| Molecular Formula | C16H17ClN4O4 |
| Molecular Weight | 364.79 g/mol |
| Exact Mass | 364.09 |
| IUPAC Name | ethyl 3-[(2Z)-2-(1-chloro-2-ethoxy-2-oxoethylidene)hydrazinyl]-5-phenyl-1H-pyrazole-4-carboxylate |
| SMILES | CCOC(=O)/C(Cl)=N/Nc1n[nH]c(-c2ccccc2)c1C(=O)OCC |
| InChI | InChI=1S/C16H17ClN4O4/c1-3-24-15(22)11-12(10-8-6-5-7-9-10)18-20-14(11)21-19-13(17)16(23)25-4-2/h5-9H,3-4H2,1-2H3,(H2,18,20,21)/b19-13- |
| InChIKey | JFTIEGHOOIUKRW-UYRXBGFRSA-N |
| XLogP | 2.78 |
| TPSA | 105.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.79 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|