C12H10N6OSSe — CID 139219828
2-(4-phenylselenadiazol-5-yl)sulfanyl-N-(1H-1,2,4-triazol-5-yl)acetamide (PubChem CID 139219828) has the molecular formula C12H10N6OSSe and a molecular weight of 365.28 g/mol. Its IUPAC name is 2-(4-phenylselenadiazol-5-yl)sulfanyl-N-(1H-1,2,4-triazol-5-yl)acetamide.
| Compound Name | 2-(4-phenylselenadiazol-5-yl)sulfanyl-N-(1H-1,2,4-triazol-5-yl)acetamide |
|---|---|
| PubChem CID | 139219828 |
| Molecular Formula | C12H10N6OSSe |
| Molecular Weight | 365.28 g/mol |
| Exact Mass | 365.98 |
| IUPAC Name | 2-(4-phenylselenadiazol-5-yl)sulfanyl-N-(1H-1,2,4-triazol-5-yl)acetamide |
| SMILES | O=C(CSc1[se]nnc1-c1ccccc1)Nc1ncn[nH]1 |
| InChI | InChI=1S/C12H10N6OSSe/c19-9(15-12-13-7-14-17-12)6-20-11-10(16-18-21-11)8-4-2-1-3-5-8/h1-5,7H,6H2,(H2,13,14,15,17,19) |
| InChIKey | REKIQLWOSIHYSD-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.28 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|