C13H12N6OSSe — CID 139219831
2-[4-(4-methylphenyl)selenadiazol-5-yl]sulfanyl-N-(1H-1,2,4-triazol-5-yl)acetamide (PubChem CID 139219831) has the molecular formula C13H12N6OSSe and a molecular weight of 379.31 g/mol. Its IUPAC name is 2-[4-(4-methylphenyl)selenadiazol-5-yl]sulfanyl-N-(1H-1,2,4-triazol-5-yl)acetamide.
| Compound Name | 2-[4-(4-methylphenyl)selenadiazol-5-yl]sulfanyl-N-(1H-1,2,4-triazol-5-yl)acetamide |
|---|---|
| PubChem CID | 139219831 |
| Molecular Formula | C13H12N6OSSe |
| Molecular Weight | 379.31 g/mol |
| Exact Mass | 380.00 |
| IUPAC Name | 2-[4-(4-methylphenyl)selenadiazol-5-yl]sulfanyl-N-(1H-1,2,4-triazol-5-yl)acetamide |
| SMILES | Cc1ccc(-c2nn[se]c2SCC(=O)Nc2ncn[nH]2)cc1 |
| InChI | InChI=1S/C13H12N6OSSe/c1-8-2-4-9(5-3-8)11-12(22-19-17-11)21-6-10(20)16-13-14-7-15-18-13/h2-5,7H,6H2,1H3,(H2,14,15,16,18,20) |
| InChIKey | RCDCWUYWGHKQOQ-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.31 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|