C25H27N3O5 — CID 139224060
3-ethyl-7-[2-hydroxy-3-[4-[(4-methylphenoxy)methyl]triazol-1-yl]propoxy]-4-methylchromen-2-one (PubChem CID 139224060) has the molecular formula C25H27N3O5 and a molecular weight of 449.51 g/mol. Its IUPAC name is 3-ethyl-7-[2-hydroxy-3-[4-[(4-methylphenoxy)methyl]triazol-1-yl]propoxy]-4-methylchromen-2-one.
| Compound Name | 3-ethyl-7-[2-hydroxy-3-[4-[(4-methylphenoxy)methyl]triazol-1-yl]propoxy]-4-methylchromen-2-one |
|---|---|
| PubChem CID | 139224060 |
| Molecular Formula | C25H27N3O5 |
| Molecular Weight | 449.51 g/mol |
| Exact Mass | 449.20 |
| IUPAC Name | 3-ethyl-7-[2-hydroxy-3-[4-[(4-methylphenoxy)methyl]triazol-1-yl]propoxy]-4-methylchromen-2-one |
| SMILES | CCc1c(C)c2ccc(OCC(O)Cn3cc(COc4ccc(C)cc4)nn3)cc2oc1=O |
| InChI | InChI=1S/C25H27N3O5/c1-4-22-17(3)23-10-9-21(11-24(23)33-25(22)30)32-15-19(29)13-28-12-18(26-27-28)14-31-20-7-5-16(2)6-8-20/h5-12,19,29H,4,13-15H2,1-3H3 |
| InChIKey | YFEGVNQGDLHQKO-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 99.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.51 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|