C26H29FN2O5 — CID 162516456
1-[3-[3-[(4-fluorophenyl)methyl]-4-methyl-2-oxochromen-7-yl]oxy-2-hydroxypropyl]piperidine-4-carboxamide (PubChem CID 162516456) has the molecular formula C26H29FN2O5 and a molecular weight of 468.53 g/mol. Its IUPAC name is 1-[3-[3-[(4-fluorophenyl)methyl]-4-methyl-2-oxochromen-7-yl]oxy-2-hydroxypropyl]piperidine-4-carboxamide.
| Compound Name | 1-[3-[3-[(4-fluorophenyl)methyl]-4-methyl-2-oxochromen-7-yl]oxy-2-hydroxypropyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 162516456 |
| Molecular Formula | C26H29FN2O5 |
| Molecular Weight | 468.53 g/mol |
| Exact Mass | 468.21 |
| IUPAC Name | 1-[3-[3-[(4-fluorophenyl)methyl]-4-methyl-2-oxochromen-7-yl]oxy-2-hydroxypropyl]piperidine-4-carboxamide |
| SMILES | Cc1c(Cc2ccc(F)cc2)c(=O)oc2cc(OCC(O)CN3CCC(C(N)=O)CC3)ccc12 |
| InChI | InChI=1S/C26H29FN2O5/c1-16-22-7-6-21(33-15-20(30)14-29-10-8-18(9-11-29)25(28)31)13-24(22)34-26(32)23(16)12-17-2-4-19(27)5-3-17/h2-7,13,18,20,30H,8-12,14-15H2,1H3,(H2,28,31) |
| InChIKey | MKIXRVLXVSIEKS-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 106.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.53 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|