C33H33FN2O6 — CID 162516398
1-[3-[3-[[4-(3-fluoro-4-formylphenyl)phenyl]methyl]-4-methyl-2-oxochromen-7-yl]oxy-2-hydroxypropyl]piperidine-4-carboxamide (PubChem CID 162516398) has the molecular formula C33H33FN2O6 and a molecular weight of 572.63 g/mol. Its IUPAC name is 1-[3-[3-[[4-(3-fluoro-4-formylphenyl)phenyl]methyl]-4-methyl-2-oxochromen-7-yl]oxy-2-hydroxypropyl]piperidine-4-carboxamide.
| Compound Name | 1-[3-[3-[[4-(3-fluoro-4-formylphenyl)phenyl]methyl]-4-methyl-2-oxochromen-7-yl]oxy-2-hydroxypropyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 162516398 |
| Molecular Formula | C33H33FN2O6 |
| Molecular Weight | 572.63 g/mol |
| Exact Mass | 572.23 |
| IUPAC Name | 1-[3-[3-[[4-(3-fluoro-4-formylphenyl)phenyl]methyl]-4-methyl-2-oxochromen-7-yl]oxy-2-hydroxypropyl]piperidine-4-carboxamide |
| SMILES | Cc1c(Cc2ccc(-c3ccc(C=O)c(F)c3)cc2)c(=O)oc2cc(OCC(O)CN3CCC(C(N)=O)CC3)ccc12 |
| InChI | InChI=1S/C33H33FN2O6/c1-20-28-9-8-27(41-19-26(38)17-36-12-10-23(11-13-36)32(35)39)16-31(28)42-33(40)29(20)14-21-2-4-22(5-3-21)24-6-7-25(18-37)30(34)15-24/h2-9,15-16,18,23,26,38H,10-14,17,19H2,1H3,(H2,35,39) |
| InChIKey | JQPVHUSICQNXDD-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 123.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.63 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|